Difference between revisions of "CPD-11938"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLC-1-P == * common-name: ** α-d-glucopyranose 1-phosphate * smiles: ** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) * inchi-key: ** h...") |
(Created page with "Category:metabolite == Metabolite CPD-9872 == * common-name: ** 6-methoxy-3-methyl-2-all-trans-nonaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-9872 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 6-methoxy-3-methyl-2-all-trans-nonaprenyl-1,4-benzoquinol |
* smiles: | * smiles: | ||
| − | ** c( | + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** glnrsjsltucxtp-iqsnhbbhsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 767.229 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-9242]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=6-methoxy-3-methyl-2-all-trans-nonaprenyl-1,4-benzoquinol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=glnrsjsltucxtp-iqsnhbbhsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=767.229}} |
Revision as of 15:27, 5 January 2021
Contents
Metabolite CPD-9872
- common-name:
- 6-methoxy-3-methyl-2-all-trans-nonaprenyl-1,4-benzoquinol
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c)c
- inchi-key:
- glnrsjsltucxtp-iqsnhbbhsa-n
- molecular-weight:
- 767.229
