Difference between revisions of "CPD-11938"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite G-protein-coupled-receptors == * common-name: ** a g protein-coupled receptor == Reaction(s) known to consume the compound == * 2.7.11....") |
(Created page with "Category:metabolite == Metabolite GAMA-TOCOPHEROL == * common-name: ** γ-tocopherol * smiles: ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=c(c)c(=c(o1)2)c)) * inchi-ke...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite GAMA-TOCOPHEROL == |
* common-name: | * common-name: | ||
| − | ** | + | ** γ-tocopherol |
| + | * smiles: | ||
| + | ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=c(c)c(=c(o1)2)c)) | ||
| + | * inchi-key: | ||
| + | ** quedxnhftdjviy-dqczwyhmsa-n | ||
| + | * molecular-weight: | ||
| + | ** 416.686 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[TOCOPHEROL-O-METHYLTRANSFERASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=γ-tocopherol}} |
| + | {{#set: inchi-key=inchikey=quedxnhftdjviy-dqczwyhmsa-n}} | ||
| + | {{#set: molecular-weight=416.686}} | ||
Revision as of 18:55, 14 January 2021
Contents
Metabolite GAMA-TOCOPHEROL
- common-name:
- γ-tocopherol
- smiles:
- cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=c(c)c(=c(o1)2)c))
- inchi-key:
- quedxnhftdjviy-dqczwyhmsa-n
- molecular-weight:
- 416.686
