Difference between revisions of "CPD-11939"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Unspecified-Degradation-Products == * common-name: ** [unspecified degradation products] == Reaction(s) known to consume the compound ==...") |
(Created page with "Category:metabolite == Metabolite CPD-11939 == * common-name: ** 3,5-bisdiphosphoinositol-1d-myo-inositol 2,3,4,6-tetrakisphosphate * smiles: ** c1(op([o-])([o-])=o)(c(op(...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-11939 == |
* common-name: | * common-name: | ||
− | ** [ | + | ** 3,5-bisdiphosphoinositol-1d-myo-inositol 2,3,4,6-tetrakisphosphate |
+ | * smiles: | ||
+ | ** c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op(=o)([o-])op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])op([o-])(=o)[o-])c(op([o-])([o-])=o)1) | ||
+ | * inchi-key: | ||
+ | ** hhqooerqsfjgep-zsiqdkgesa-a | ||
+ | * molecular-weight: | ||
+ | ** 805.885 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-10976]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-10973]] |
− | * [[RXN- | + | * [[RXN-10976]] |
+ | * [[RXN-10979]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3,5-bisdiphosphoinositol-1d-myo-inositol 2,3,4,6-tetrakisphosphate}} |
+ | {{#set: inchi-key=inchikey=hhqooerqsfjgep-zsiqdkgesa-a}} | ||
+ | {{#set: molecular-weight=805.885}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-11939
- common-name:
- 3,5-bisdiphosphoinositol-1d-myo-inositol 2,3,4,6-tetrakisphosphate
- smiles:
- c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op(=o)([o-])op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])op([o-])(=o)[o-])c(op([o-])([o-])=o)1)
- inchi-key:
- hhqooerqsfjgep-zsiqdkgesa-a
- molecular-weight:
- 805.885