Difference between revisions of "CPD-11975"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PYRIDOXAL == * common-name: ** pyridoxal * smiles: ** cc1(n=cc(=c(c=1o)c=o)co) * inchi-key: ** radkzdmfgjycbb-uhfffaoysa-n * molecular-we...")
(Created page with "Category:metabolite == Metabolite CPD-9096 == * common-name: ** bacteriopheophytin a * smiles: ** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(ccc(occ=c(c)cccc(c)cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PYRIDOXAL ==
+
== Metabolite CPD-9096 ==
 
* common-name:
 
* common-name:
** pyridoxal
+
** bacteriopheophytin a
 
* smiles:
 
* smiles:
** cc1(n=cc(=c(c=1o)c=o)co)
+
** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(ccc(occ=c(c)cccc(c)cccc(c)cccc(c)c)=o)c(c)c(=n2)c=c3(c(c)=c(c(c)=o)c(n3)=cc(=n4)c(c)5)))n6))))
 
* inchi-key:
 
* inchi-key:
** radkzdmfgjycbb-uhfffaoysa-n
+
** qgudpqyomulita-zasykxldsa-n
 
* molecular-weight:
 
* molecular-weight:
** 167.164
+
** 888.221
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PYRIDOXINE-4-DEHYDROGENASE-RXN]]
 
* [[PYRIDOXKIN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.3.74-RXN]]
+
* [[RXN-17427]]
* [[PYRIDOXINE-4-DEHYDROGENASE-RXN]]
+
* [[RXN-8796]]
* [[PYRIDOXINE-4-OXIDASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pyridoxal}}
+
{{#set: common-name=bacteriopheophytin a}}
{{#set: inchi-key=inchikey=radkzdmfgjycbb-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=qgudpqyomulita-zasykxldsa-n}}
{{#set: molecular-weight=167.164}}
+
{{#set: molecular-weight=888.221}}

Revision as of 08:27, 15 March 2021

Metabolite CPD-9096

  • common-name:
    • bacteriopheophytin a
  • smiles:
    • ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(ccc(occ=c(c)cccc(c)cccc(c)cccc(c)c)=o)c(c)c(=n2)c=c3(c(c)=c(c(c)=o)c(n3)=cc(=n4)c(c)5)))n6))))
  • inchi-key:
    • qgudpqyomulita-zasykxldsa-n
  • molecular-weight:
    • 888.221

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality