Difference between revisions of "CPD-11975"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ10725 == * transcription-direction: ** positive * right-end-position: ** 20834 * left-end-position: ** 12067 * centisome-position: ** 44.146484...")
(Created page with "Category:metabolite == Metabolite CPD-11975 == * common-name: ** 1-o-(2-acetamido-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol 3-phosphate * smiles: ** cc(=o)nc2(c(oc...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ10725 ==
+
== Metabolite CPD-11975 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 1-o-(2-acetamido-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol 3-phosphate
−
* right-end-position:
+
* smiles:
−
** 20834
+
** cc(=o)nc2(c(oc1(c(o)c(o)c(o)c(op([o-])(=o)[o-])c(o)1))oc(c(c2o)o)co)
−
* left-end-position:
+
* inchi-key:
−
** 12067
+
** chttvmdqgbocme-dnswdbfxsa-l
−
* centisome-position:
+
* molecular-weight:
−
** 44.146484   
+
** 461.316
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-6501]]
−
* [[DIHYDLIPACETRANS-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=1-o-(2-acetamido-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol 3-phosphate}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=chttvmdqgbocme-dnswdbfxsa-l}}
−
* [[PYRUVDEH-RXN]]
+
{{#set: molecular-weight=461.316}}
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN0-1133]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7384]]
 
−
** '''6''' reactions found over '''10''' reactions in the full pathway
 
−
* [[GLYCOLYSIS-TCA-GLYOX-BYPASS]]
 
−
** '''3''' reactions found over '''1''' reactions in the full pathway
 
−
* [[PWY-7218]]
 
−
** '''7''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-5482]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-5537]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-6886]]
 
−
** '''8''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PYRUVDEHYD-PWY]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=20834}}
 
−
{{#set: left-end-position=12067}}
 
−
{{#set: centisome-position=44.146484    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=3}}
 
−
{{#set: nb pathway associated=7}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-11975

  • common-name:
    • 1-o-(2-acetamido-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol 3-phosphate
  • smiles:
    • cc(=o)nc2(c(oc1(c(o)c(o)c(o)c(op([o-])(=o)[o-])c(o)1))oc(c(c2o)o)co)
  • inchi-key:
    • chttvmdqgbocme-dnswdbfxsa-l
  • molecular-weight:
    • 461.316

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-11975&oldid=138079"