Difference between revisions of "CPD-11975"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-405 == * common-name: ** a phosphatidyl-n-methylethanolamine == Reaction(s) known to consume the compound == * 2.1.1.71-RXN == Re...") |
(Created page with "Category:metabolite == Metabolite CPD-11975 == * common-name: ** 1-o-(2-acetamido-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol 3-phosphate * smiles: ** cc(=o)nc2(c(oc...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-11975 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-o-(2-acetamido-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol 3-phosphate |
| + | * smiles: | ||
| + | ** cc(=o)nc2(c(oc1(c(o)c(o)c(o)c(op([o-])(=o)[o-])c(o)1))oc(c(c2o)o)co) | ||
| + | * inchi-key: | ||
| + | ** chttvmdqgbocme-dnswdbfxsa-l | ||
| + | * molecular-weight: | ||
| + | ** 461.316 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-6501]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-o-(2-acetamido-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol 3-phosphate}} |
| + | {{#set: inchi-key=inchikey=chttvmdqgbocme-dnswdbfxsa-l}} | ||
| + | {{#set: molecular-weight=461.316}} | ||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-11975
- common-name:
- 1-o-(2-acetamido-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol 3-phosphate
- smiles:
- cc(=o)nc2(c(oc1(c(o)c(o)c(o)c(op([o-])(=o)[o-])c(o)1))oc(c(c2o)o)co)
- inchi-key:
- chttvmdqgbocme-dnswdbfxsa-l
- molecular-weight:
- 461.316
