Difference between revisions of "CPD-11975"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-474 == * common-name: ** (+)-taxifolin * smiles: ** c1(c=c(o)c(o)=cc=1c2(oc3(c=c([o-])c=c(o)c(c(=o)c(o)2)=3))) * inchi-key: ** cxqwrc...") |
(Created page with "Category:metabolite == Metabolite CPD-405 == * common-name: ** a phosphatidyl-n-methylethanolamine == Reaction(s) known to consume the compound == * 2.1.1.71-RXN == Re...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-405 == |
* common-name: | * common-name: | ||
− | ** | + | ** a phosphatidyl-n-methylethanolamine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.1.1.71-RXN]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[2.1.1.17-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a phosphatidyl-n-methylethanolamine}} |
− | |||
− |
Revision as of 18:55, 14 January 2021
Contents
Metabolite CPD-405
- common-name:
- a phosphatidyl-n-methylethanolamine