Difference between revisions of "CPD-12014"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ00231 == * transcription-direction: ** negative * right-end-position: ** 103812 * left-end-position: ** 89822 * centisome-position: ** 15.766377...")
(Created page with "Category:metabolite == Metabolite CPD-12014 == * common-name: ** 6-hydroxymelatonin * smiles: ** cc(=o)nccc1(=cnc2(c1=cc(oc)=c(o)c=2)) * inchi-key: ** omymrcxojjzyke-uhfff...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ00231 ==
+
== Metabolite CPD-12014 ==
* transcription-direction:
+
* common-name:
** negative
+
** 6-hydroxymelatonin
* right-end-position:
+
* smiles:
** 103812
+
** cc(=o)nccc1(=cnc2(c1=cc(oc)=c(o)c=2))
* left-end-position:
+
* inchi-key:
** 89822
+
** omymrcxojjzyke-uhfffaoysa-n
* centisome-position:
+
* molecular-weight:
** 15.766377   
+
** 248.281
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-11058]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[DTDPGLUCDEHYDRAT-RXN]]
+
* [[RXN-11056]]
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: common-name=6-hydroxymelatonin}}
* [[UDP-GLUCURONATE-DECARBOXYLASE-RXN]]
+
{{#set: inchi-key=inchikey=omymrcxojjzyke-uhfffaoysa-n}}
** Category: [[annotation]]
+
{{#set: molecular-weight=248.281}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[UGDC]]
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
== Pathway(s) associated ==
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
* [[PWY-6808]]
 
** '''1''' reactions found over '''9''' reactions in the full pathway
 
* [[PWY-7657]]
 
** '''1''' reactions found over '''7''' reactions in the full pathway
 
* [[PWY-7104]]
 
** '''1''' reactions found over '''8''' reactions in the full pathway
 
* [[PWY-6973]]
 
** '''1''' reactions found over '''9''' reactions in the full pathway
 
* [[PWY-6974]]
 
** '''1''' reactions found over '''7''' reactions in the full pathway
 
* [[PWY-6976]]
 
** '''1''' reactions found over '''7''' reactions in the full pathway
 
* [[PWY-6953]]
 
** '''1''' reactions found over '''5''' reactions in the full pathway
 
* [[PWY-7414]]
 
** '''1''' reactions found over '''5''' reactions in the full pathway
 
* [[PWY-7315]]
 
** '''1''' reactions found over '''4''' reactions in the full pathway
 
* [[PWY-7318]]
 
** '''1''' reactions found over '''5''' reactions in the full pathway
 
* [[PWY-6942]]
 
** '''1''' reactions found over '''6''' reactions in the full pathway
 
* [[PWY-7440]]
 
** '''1''' reactions found over '''8''' reactions in the full pathway
 
* [[PWY-7814]]
 
** '''2''' reactions found over '''6''' reactions in the full pathway
 
* [[PWY-3221]]
 
** '''1''' reactions found over '''n.a''' reactions in the full pathway
 
* [[PWY-7413]]
 
** '''1''' reactions found over '''4''' reactions in the full pathway
 
* [[PWY-7312]]
 
** '''1''' reactions found over '''4''' reactions in the full pathway
 
* [[PWY-7316]]
 
** '''1''' reactions found over '''4''' reactions in the full pathway
 
* [[DTDPRHAMSYN-PWY]]
 
** '''3''' reactions found over '''4''' reactions in the full pathway
 
* [[PWY-7688]]
 
** '''1''' reactions found over '''6''' reactions in the full pathway
 
* [[PWY-7301]]
 
** '''2''' reactions found over '''5''' reactions in the full pathway
 
* [[PWY-4821]]
 
** '''2''' reactions found over '''1''' reactions in the full pathway
 
</div>
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=103812}}
 
{{#set: left-end-position=89822}}
 
{{#set: centisome-position=15.766377    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=3}}
 
{{#set: nb pathway associated=21}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-12014

  • common-name:
    • 6-hydroxymelatonin
  • smiles:
    • cc(=o)nccc1(=cnc2(c1=cc(oc)=c(o)c=2))
  • inchi-key:
    • omymrcxojjzyke-uhfffaoysa-n
  • molecular-weight:
    • 248.281

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality