Difference between revisions of "CPD-12014"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ02107 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite DIHYDROKAEMPFEROL-CMPD == * common-name: ** (+)-dihydrokaempferol * smiles: ** c1(=c(c=cc(=c1)o)c2(oc3(c(c(c2o)=o)=c(o)c=c(o)c=3))) * inc...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite DIHYDROKAEMPFEROL-CMPD == |
− | + | * common-name: | |
− | * | + | ** (+)-dihydrokaempferol |
− | == | + | * smiles: |
− | * | + | ** c1(=c(c=cc(=c1)o)c2(oc3(c(c(c2o)=o)=c(o)c=c(o)c=3))) |
− | ** | + | * inchi-key: |
− | ** | + | ** padqinqhpqkxnl-lsdhhaiusa-n |
− | * [[RXN | + | * molecular-weight: |
− | * | + | ** 288.256 |
− | + | == Reaction(s) known to consume the compound == | |
− | == | + | * [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]] |
− | * [[ | + | * [[RXN1F-93]] |
− | + | == Reaction(s) known to produce the compound == | |
− | {{#set: | + | * [[NARINGENIN-3-DIOXYGENASE-RXN]] |
− | {{#set: | + | == Reaction(s) of unknown directionality == |
− | {{#set: | + | {{#set: common-name=(+)-dihydrokaempferol}} |
+ | {{#set: inchi-key=inchikey=padqinqhpqkxnl-lsdhhaiusa-n}} | ||
+ | {{#set: molecular-weight=288.256}} |
Revision as of 20:31, 18 December 2020
Contents
Metabolite DIHYDROKAEMPFEROL-CMPD
- common-name:
- (+)-dihydrokaempferol
- smiles:
- c1(=c(c=cc(=c1)o)c2(oc3(c(c(c2o)=o)=c(o)c=c(o)c=3)))
- inchi-key:
- padqinqhpqkxnl-lsdhhaiusa-n
- molecular-weight:
- 288.256