Difference between revisions of "CPD-12015"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OXIDIZED-DITHIOTHREITOL == * common-name: ** oxidized dithiothreitol * smiles: ** c1(sscc(o)c(o)1) * inchi-key: ** ypgmowhxeqdbbv-imjsidk...")
(Created page with "Category:metabolite == Metabolite CPD-12015 == * common-name: ** 6-sulfatoxymelatonin * smiles: ** cc(=o)nccc1(c2(=c(nc=1)c=c(os([o-])(=o)=o)c(oc)=c2)) * inchi-key: ** qqe...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OXIDIZED-DITHIOTHREITOL ==
+
== Metabolite CPD-12015 ==
 
* common-name:
 
* common-name:
** oxidized dithiothreitol
+
** 6-sulfatoxymelatonin
 
* smiles:
 
* smiles:
** c1(sscc(o)c(o)1)
+
** cc(=o)nccc1(c2(=c(nc=1)c=c(os([o-])(=o)=o)c(oc)=c2))
 
* inchi-key:
 
* inchi-key:
** ypgmowhxeqdbbv-imjsidkusa-n
+
** qqeilxdlzrltme-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 152.226
+
** 327.331
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.4.1-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.4.1-RXN]]
+
* [[RXN-11058]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=oxidized dithiothreitol}}
+
{{#set: common-name=6-sulfatoxymelatonin}}
{{#set: inchi-key=inchikey=ypgmowhxeqdbbv-imjsidkusa-n}}
+
{{#set: inchi-key=inchikey=qqeilxdlzrltme-uhfffaoysa-m}}
{{#set: molecular-weight=152.226}}
+
{{#set: molecular-weight=327.331}}

Revision as of 11:17, 15 January 2021

Metabolite CPD-12015

  • common-name:
    • 6-sulfatoxymelatonin
  • smiles:
    • cc(=o)nccc1(c2(=c(nc=1)c=c(os([o-])(=o)=o)c(oc)=c2))
  • inchi-key:
    • qqeilxdlzrltme-uhfffaoysa-m
  • molecular-weight:
    • 327.331

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality