Difference between revisions of "CPD-12015"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13040 == * common-name: ** 1,2-dibutyrin * smiles: ** cccc(occ(oc(ccc)=o)co)=o * inchi-key: ** awhaupzhzyuhom-vifpvbqesa-n * molecula...") |
(Created page with "Category:metabolite == Metabolite CPD-12015 == * common-name: ** 6-sulfatoxymelatonin * smiles: ** cc(=o)nccc1(c2(=c(nc=1)c=c(os([o-])(=o)=o)c(oc)=c2)) * inchi-key: ** qqe...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-12015 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 6-sulfatoxymelatonin |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=o)nccc1(c2(=c(nc=1)c=c(os([o-])(=o)=o)c(oc)=c2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qqeilxdlzrltme-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 327.331 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-11058]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=6-sulfatoxymelatonin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qqeilxdlzrltme-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=327.331}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-12015
- common-name:
- 6-sulfatoxymelatonin
- smiles:
- cc(=o)nccc1(c2(=c(nc=1)c=c(os([o-])(=o)=o)c(oc)=c2))
- inchi-key:
- qqeilxdlzrltme-uhfffaoysa-m
- molecular-weight:
- 327.331
