Difference between revisions of "CPD-12015"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13415 RXN-13415] == * direction: ** left-to-right == Reaction formula == * 1 CPD-14378[c] '...") |
(Created page with "Category:metabolite == Metabolite CPD-12015 == * common-name: ** 6-sulfatoxymelatonin * smiles: ** cc(=o)nccc1(c2(=c(nc=1)c=c(os([o-])(=o)=o)c(oc)=c2)) * inchi-key: ** qqe...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-12015 == |
| − | * | + | * common-name: |
| − | ** | + | ** 6-sulfatoxymelatonin |
| − | == | + | * smiles: |
| − | + | ** cc(=o)nccc1(c2(=c(nc=1)c=c(os([o-])(=o)=o)c(oc)=c2)) | |
| − | == | + | * inchi-key: |
| − | * | + | ** qqeilxdlzrltme-uhfffaoysa-m |
| − | ** | + | * molecular-weight: |
| − | * | + | ** 327.331 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | * [[RXN-11058]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=6-sulfatoxymelatonin}} | |
| − | + | {{#set: inchi-key=inchikey=qqeilxdlzrltme-uhfffaoysa-m}} | |
| − | * | + | {{#set: molecular-weight=327.331}} |
| − | |||
| − | == | ||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-12015
- common-name:
- 6-sulfatoxymelatonin
- smiles:
- cc(=o)nccc1(c2(=c(nc=1)c=c(os([o-])(=o)=o)c(oc)=c2))
- inchi-key:
- qqeilxdlzrltme-uhfffaoysa-m
- molecular-weight:
- 327.331
