Difference between revisions of "CPD-12015"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.5.1.52-RXN 3.5.1.52-RXN] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.o...")
(Created page with "Category:metabolite == Metabolite CPD-12015 == * common-name: ** 6-sulfatoxymelatonin * smiles: ** cc(=o)nccc1(c2(=c(nc=1)c=c(os([o-])(=o)=o)c(oc)=c2)) * inchi-key: ** qqe...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.5.1.52-RXN 3.5.1.52-RXN] ==
+
== Metabolite CPD-12015 ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** 6-sulfatoxymelatonin
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/3.5.1.52 ec-3.5.1.52]
+
** cc(=o)nccc1(c2(=c(nc=1)c=c(os([o-])(=o)=o)c(oc)=c2))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-8541]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[N-ACETYL-BETA-GLUCOSAMINYLAMINE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Protein-L-Aspartates]][c]
+
** qqeilxdlzrltme-uhfffaoysa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ10678]]
+
** 327.331
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[RXN-11058]]
−
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=6-sulfatoxymelatonin}}
−
== External links  ==
+
{{#set: inchi-key=inchikey=qqeilxdlzrltme-uhfffaoysa-m}}
−
* UNIPROT:
+
{{#set: molecular-weight=327.331}}
−
** [http://www.uniprot.org/uniprot/P81898 P81898]
 
−
** [http://www.uniprot.org/uniprot/P21163 P21163]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: ec-number=ec-3.5.1.52}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-12015

  • common-name:
    • 6-sulfatoxymelatonin
  • smiles:
    • cc(=o)nccc1(c2(=c(nc=1)c=c(os([o-])(=o)=o)c(oc)=c2))
  • inchi-key:
    • qqeilxdlzrltme-uhfffaoysa-m
  • molecular-weight:
    • 327.331

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-12015&oldid=138767"