Difference between revisions of "CPD-12016"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ18078 == * transcription-direction: ** positive * right-end-position: ** 72958 * left-end-position: ** 62641 * centisome-position: ** 24.774956...")
(Created page with "Category:metabolite == Metabolite CPD-12016 == * common-name: ** n-acetyl-serotonin glucuronide * smiles: ** cc(=o)nccc2(=cnc3(=cc=c(oc1(oc(c([o-])=o)c(o)c(o)c(o)1))c=c23)...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ18078 ==
+
== Metabolite CPD-12016 ==
* transcription-direction:
+
* common-name:
** positive
+
** n-acetyl-serotonin glucuronide
* right-end-position:
+
* smiles:
** 72958
+
** cc(=o)nccc2(=cnc3(=cc=c(oc1(oc(c([o-])=o)c(o)c(o)c(o)1))c=c23))
* left-end-position:
+
* inchi-key:
** 62641
+
** drkqfnyksnwotc-rngzqalnsa-m
* centisome-position:
+
* molecular-weight:
** 24.774956   
+
** 393.372
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) associated ==
+
* [[RXN-11060]]
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) of unknown directionality ==
* [[GLYCOPHOSPHORYL-RXN]]
+
{{#set: common-name=n-acetyl-serotonin glucuronide}}
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=drkqfnyksnwotc-rngzqalnsa-m}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=393.372}}
* [[GLYMALTOPHOSPHORYL-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[MANNPGUANYLTRANGDP-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-12171]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-12392]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-12486]]
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[RXN-14284]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-14285]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-14286]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-14353]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-1826]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-9025]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN0-5182]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN0-5184]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN4FS-12]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN4FS-13]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXNQT-4141]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
</div>
 
== Pathway(s) associated ==
 
* [[PWY-5941]]
 
** '''3''' reactions found over '''6''' reactions in the full pathway
 
* [[GLYCOCAT-PWY]]
 
** '''6''' reactions found over '''8''' reactions in the full pathway
 
* [[PWY-6737]]
 
** '''2''' reactions found over '''4''' reactions in the full pathway
 
* [[PWY-6731]]
 
** '''2''' reactions found over '''4''' reactions in the full pathway
 
* [[PWY-7238]]
 
** '''5''' reactions found over '''8''' reactions in the full pathway
 
* [[PWY4FS-12]]
 
** '''2''' reactions found over '''2''' reactions in the full pathway
 
* [[PWY4FS-13]]
 
** '''2''' reactions found over '''3''' reactions in the full pathway
 
* [[PWY-882]]
 
** '''6''' reactions found over '''8''' reactions in the full pathway
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=72958}}
 
{{#set: left-end-position=62641}}
 
{{#set: centisome-position=24.774956    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=18}}
 
{{#set: nb pathway associated=8}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-12016

  • common-name:
    • n-acetyl-serotonin glucuronide
  • smiles:
    • cc(=o)nccc2(=cnc3(=cc=c(oc1(oc(c([o-])=o)c(o)c(o)c(o)1))c=c23))
  • inchi-key:
    • drkqfnyksnwotc-rngzqalnsa-m
  • molecular-weight:
    • 393.372

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality