Difference between revisions of "CPD-12017"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Myo-inositol-monophosphates == * common-name: ** a myo-inositol monophosphate == Reaction(s) known to consume the compound == * RXN-109...") |
(Created page with "Category:metabolite == Metabolite CPD-12017 == * common-name: ** n-acetyl-serotonin sulfate * smiles: ** cc(=o)nccc1(=cnc2(=cc=c(os([o-])(=o)=o)c=c12)) * inchi-key: ** uca...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-12017 == |
* common-name: | * common-name: | ||
− | ** | + | ** n-acetyl-serotonin sulfate |
+ | * smiles: | ||
+ | ** cc(=o)nccc1(=cnc2(=cc=c(os([o-])(=o)=o)c=c12)) | ||
+ | * inchi-key: | ||
+ | ** ucajznvfrvluls-uhfffaoysa-m | ||
+ | * molecular-weight: | ||
+ | ** 297.305 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-11059]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=n-acetyl-serotonin sulfate}} |
+ | {{#set: inchi-key=inchikey=ucajznvfrvluls-uhfffaoysa-m}} | ||
+ | {{#set: molecular-weight=297.305}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-12017
- common-name:
- n-acetyl-serotonin sulfate
- smiles:
- cc(=o)nccc1(=cnc2(=cc=c(os([o-])(=o)=o)c=c12))
- inchi-key:
- ucajznvfrvluls-uhfffaoysa-m
- molecular-weight:
- 297.305