Difference between revisions of "CPD-12017"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ03588 == * transcription-direction: ** negative * right-end-position: ** 42403 * left-end-position: ** 29045 * centisome-position: ** 24.511375...")
(Created page with "Category:metabolite == Metabolite CPD-12017 == * common-name: ** n-acetyl-serotonin sulfate * smiles: ** cc(=o)nccc1(=cnc2(=cc=c(os([o-])(=o)=o)c=c12)) * inchi-key: ** uca...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ03588 ==
+
== Metabolite CPD-12017 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** n-acetyl-serotonin sulfate
−
* right-end-position:
+
* smiles:
−
** 42403
+
** cc(=o)nccc1(=cnc2(=cc=c(os([o-])(=o)=o)c=c12))
−
* left-end-position:
+
* inchi-key:
−
** 29045
+
** ucajznvfrvluls-uhfffaoysa-m
−
* centisome-position:
+
* molecular-weight:
−
** 24.511375   
+
** 297.305
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-11059]]
−
* [[3.1.3.56-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=n-acetyl-serotonin sulfate}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=ucajznvfrvluls-uhfffaoysa-m}}
−
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
+
{{#set: molecular-weight=297.305}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[PHOSPHATIDYLINOSITOL-BISPHOSPHATASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-8730]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6363]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-6368]]
 
−
** '''6''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-6362]]
 
−
** '''5''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-6364]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=42403}}
 
−
{{#set: left-end-position=29045}}
 
−
{{#set: centisome-position=24.511375    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=4}}
 
−
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-12017

  • common-name:
    • n-acetyl-serotonin sulfate
  • smiles:
    • cc(=o)nccc1(=cnc2(=cc=c(os([o-])(=o)=o)c=c12))
  • inchi-key:
    • ucajznvfrvluls-uhfffaoysa-m
  • molecular-weight:
    • 297.305

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-12017&oldid=137642"