Difference between revisions of "CPD-12019"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PROTOPORPHYRIN_IX == * common-name: ** protoporphyrin ix * smiles: ** c=cc1(c(c)=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=...")
(Created page with "Category:metabolite == Metabolite L-1-PHOSPHATIDYL-GLYCEROL-P == * common-name: ** 1-(3-sn-phosphatidyl)-sn-glycerol 3-phosphate == Reaction(s) known to consume the compou...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PROTOPORPHYRIN_IX ==
+
== Metabolite L-1-PHOSPHATIDYL-GLYCEROL-P ==
 
* common-name:
 
* common-name:
** protoporphyrin ix
+
** 1-(3-sn-phosphatidyl)-sn-glycerol 3-phosphate
* smiles:
 
** c=cc1(c(c)=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=cc3(c(c=c)=c(c)c(=cc=1n2)n=3))n4))=n5)))
 
* inchi-key:
 
** ksfovussgskxfi-ujjxfscmsa-l
 
* molecular-weight:
 
** 560.651
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PROTOHEMEFERROCHELAT-RXN]]
+
* [[PGPPHOSPHA-RXN]]
* [[RXN1F-20]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PPPGO]]
+
* [[PHOSPHAGLYPSYN-RXN]]
* [[PROTOHEMEFERROCHELAT-RXN]]
 
* [[PROTOPORGENOXI-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=protoporphyrin ix}}
+
{{#set: common-name=1-(3-sn-phosphatidyl)-sn-glycerol 3-phosphate}}
{{#set: inchi-key=inchikey=ksfovussgskxfi-ujjxfscmsa-l}}
 
{{#set: molecular-weight=560.651}}
 

Revision as of 13:08, 14 January 2021

Metabolite L-1-PHOSPHATIDYL-GLYCEROL-P

  • common-name:
    • 1-(3-sn-phosphatidyl)-sn-glycerol 3-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality