Difference between revisions of "CPD-12115"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-ALLO-THREONINE == * common-name: ** l-allo-threonine * smiles: ** cc(o)c([n+])c(=o)[o-] * inchi-key: ** ayfvyjqapqtccc-hrfvkafmsa-n * m...") |
(Created page with "Category:metabolite == Metabolite CPD-12115 == * common-name: ** demethylmenaquinol-8 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-12115 == |
* common-name: | * common-name: | ||
| − | ** | + | ** demethylmenaquinol-8 |
* smiles: | * smiles: | ||
| − | ** cc( | + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fgypgicsxjekcg-aendiincsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 705.118 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ADOMET-DMK-METHYLTRANSFER-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=demethylmenaquinol-8}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fgypgicsxjekcg-aendiincsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=705.118}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-12115
- common-name:
- demethylmenaquinol-8
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2))
- inchi-key:
- fgypgicsxjekcg-aendiincsa-n
- molecular-weight:
- 705.118
