Difference between revisions of "CPD-12116"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15016 == * common-name: ** (4s)-4-hydroxy-2-oxoglutarate * smiles: ** c(c(=o)c([o-])=o)c(c([o-])=o)o * inchi-key: ** wxskvkpsmahcsg-r...") |
(Created page with "Category:metabolite == Metabolite beta-Gal-13-alpha-GalNac-R == * common-name: ** a type 3 histo-blood group antigen precursor disaccharide == Reaction(s) known to consume...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite beta-Gal-13-alpha-GalNac-R == |
* common-name: | * common-name: | ||
| − | ** | + | ** a type 3 histo-blood group antigen precursor disaccharide |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-18266]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a type 3 histo-blood group antigen precursor disaccharide}} |
| − | |||
| − | |||
Revision as of 11:20, 15 January 2021
Contents
Metabolite beta-Gal-13-alpha-GalNac-R
- common-name:
- a type 3 histo-blood group antigen precursor disaccharide
