Difference between revisions of "CPD-12116"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13298 RXN-13298] == * direction: ** left-to-right * common-name: ** 3-oxo-arachidoyl-coa reduct...")
(Created page with "Category:metabolite == Metabolite CPD-12116 == * common-name: ** demethylmenaquinol-6 * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13298 RXN-13298] ==
+
== Metabolite CPD-12116 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** 3-oxo-arachidoyl-coa reductase
+
** demethylmenaquinol-6
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.1.1.330 ec-1.1.1.330]
+
** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
== Reaction formula ==
+
* inchi-key:
* 1 [[CPD-14271]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-14275]][c] '''+''' 1 [[NADP]][c]
+
** ufaxpzazhzpelj-rotsudqpsa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ06969]]
+
** 568.881
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-9220]]
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
* [[PWY-7036]], very long chain fatty acid biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7036 PWY-7036]
+
== Reaction(s) of unknown directionality ==
** '''14''' reactions found over '''16''' reactions in the full pathway
+
{{#set: common-name=demethylmenaquinol-6}}
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=ufaxpzazhzpelj-rotsudqpsa-n}}
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=568.881}}
== External links  ==
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=3-oxo-arachidoyl-coa reductase}}
 
{{#set: ec-number=ec-1.1.1.330}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite CPD-12116

  • common-name:
    • demethylmenaquinol-6
  • smiles:
    • cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
  • inchi-key:
    • ufaxpzazhzpelj-rotsudqpsa-n
  • molecular-weight:
    • 568.881

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality