Difference between revisions of "CPD-12116"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite beta-Gal-13-alpha-GalNac-R == * common-name: ** a type 3 histo-blood group antigen precursor disaccharide == Reaction(s) known to consume...") |
(Created page with "Category:metabolite == Metabolite CPD-12116 == * common-name: ** demethylmenaquinol-6 * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-12116 == |
* common-name: | * common-name: | ||
| − | ** | + | ** demethylmenaquinol-6 |
| + | * smiles: | ||
| + | ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c | ||
| + | * inchi-key: | ||
| + | ** ufaxpzazhzpelj-rotsudqpsa-n | ||
| + | * molecular-weight: | ||
| + | ** 568.881 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-9220]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=demethylmenaquinol-6}} |
| + | {{#set: inchi-key=inchikey=ufaxpzazhzpelj-rotsudqpsa-n}} | ||
| + | {{#set: molecular-weight=568.881}} | ||
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite CPD-12116
- common-name:
- demethylmenaquinol-6
- smiles:
- cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
- inchi-key:
- ufaxpzazhzpelj-rotsudqpsa-n
- molecular-weight:
- 568.881
