|
|
| (9 intermediate revisions by 4 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14386 RXN-14386] == | + | == Metabolite CPD-12116 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** [cysteine desulfurase]-s-sulfanylcysteine:[acceptor protein]-cysteine sulfurtransferase | + | ** demethylmenaquinol-6 |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/2.8.1.7 ec-2.8.1.7] | + | ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[S-CD-S-SP-Complex]][c] '''=>''' 1 [[CD-2S-SP-Complex]][c]
| + | ** ufaxpzazhzpelj-rotsudqpsa-n |
| − | == Gene(s) associated with this reaction == | + | * molecular-weight: |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | ** 568.881 |
| − | * Gene: [[SJ04060]]
| + | == Reaction(s) known to consume the compound == |
| − | ** Category: [[annotation]] | + | * [[RXN-9220]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[orthology]]
| + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: common-name=demethylmenaquinol-6}} |
| − | * Gene: [[SJ03223]]
| + | {{#set: inchi-key=inchikey=ufaxpzazhzpelj-rotsudqpsa-n}} |
| − | ** Category: [[annotation]]
| + | {{#set: molecular-weight=568.881}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | |
| − | * Gene: [[SJ09474]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | |
| − | * Gene: [[SJ17324]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | |
| − | * Gene: [[SJ13485]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ19133]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | * [[PWY-7250]], [2Fe-2S] iron-sulfur cluster biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7250 PWY-7250] | |
| − | ** '''5''' reactions found over '''10''' reactions in the full pathway
| |
| − | == Reconstruction information == | |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | == External links == | |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=[cysteine desulfurase]-s-sulfanylcysteine:[acceptor protein]-cysteine sulfurtransferase}} | |
| − | {{#set: ec-number=ec-2.8.1.7}} | |
| − | {{#set: nb gene associated=6}} | |
| − | {{#set: nb pathway associated=1}}
| |
| − | {{#set: reconstruction category=orthology|annotation}}
| |
| − | {{#set: reconstruction tool=pathwaytools|pantograph}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
| |
