Difference between revisions of "CPD-12116"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite beta-Gal-13-alpha-GalNac-R == * common-name: ** a type 3 histo-blood group antigen precursor disaccharide == Reaction(s) known to consume...") |
(Created page with "Category:metabolite == Metabolite L-CITRULLINE == * common-name: ** l-citrulline * smiles: ** c(nc(n)=o)ccc([n+])c(=o)[o-] * inchi-key: ** rhgklrlohdjjdr-bypyzucnsa-n * mo...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite L-CITRULLINE == |
* common-name: | * common-name: | ||
− | ** | + | ** l-citrulline |
+ | * smiles: | ||
+ | ** c(nc(n)=o)ccc([n+])c(=o)[o-] | ||
+ | * inchi-key: | ||
+ | ** rhgklrlohdjjdr-bypyzucnsa-n | ||
+ | * molecular-weight: | ||
+ | ** 175.187 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[ARGSUCCINSYN-RXN]] | ||
+ | * [[ORNCARBAMTRANSFER-RXN]] | ||
+ | * [[RXN-13482]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[DIMETHYLARGININASE-RXN]] |
+ | * [[NITRIC-OXIDE-SYNTHASE-RXN]] | ||
+ | * [[ORNCARBAMTRANSFER-RXN]] | ||
+ | * [[RXN-13482]] | ||
+ | * [[RXN-13565]] | ||
+ | * [[RXN-7933]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-citrulline}} |
+ | {{#set: inchi-key=inchikey=rhgklrlohdjjdr-bypyzucnsa-n}} | ||
+ | {{#set: molecular-weight=175.187}} |
Revision as of 15:00, 5 January 2021
Contents
Metabolite L-CITRULLINE
- common-name:
- l-citrulline
- smiles:
- c(nc(n)=o)ccc([n+])c(=o)[o-]
- inchi-key:
- rhgklrlohdjjdr-bypyzucnsa-n
- molecular-weight:
- 175.187