Difference between revisions of "CPD-12117"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-16819 == * common-name: ** 4-methylphenyl sulfate * smiles: ** cc1(c=cc(=cc=1)os(=o)(=o)[o-]) * inchi-key: ** wgnakzgusrvwrh-uhfffaoy...") |
(Created page with "Category:metabolite == Metabolite CPD-12117 == * common-name: ** demethylmenaquinol-7 * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=c...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-12117 == |
* common-name: | * common-name: | ||
| − | ** | + | ** demethylmenaquinol-7 |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ufzdimbxtvrbds-ssqlmynasa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 636.999 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-9191]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=demethylmenaquinol-7}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ufzdimbxtvrbds-ssqlmynasa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=636.999}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-12117
- common-name:
- demethylmenaquinol-7
- smiles:
- cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
- inchi-key:
- ufzdimbxtvrbds-ssqlmynasa-n
- molecular-weight:
- 636.999
