Difference between revisions of "CPD-12117"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=S-ADENMETSYN-RXN S-ADENMETSYN-RXN] == * direction: ** left-to-right * common-name: ** methionine ad...") |
(Created page with "Category:metabolite == Metabolite CPD-12117 == * common-name: ** demethylmenaquinol-7 * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=c...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-12117 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** demethylmenaquinol-7 |
− | * | + | * smiles: |
− | ** | + | ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c |
− | == | + | * inchi-key: |
− | + | ** ufzdimbxtvrbds-ssqlmynasa-n | |
− | == | + | * molecular-weight: |
− | * | + | ** 636.999 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-9191]] | |
− | * | + | == Reaction(s) known to produce the compound == |
− | ** | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=demethylmenaquinol-7}} | |
− | + | {{#set: inchi-key=inchikey=ufzdimbxtvrbds-ssqlmynasa-n}} | |
− | == | + | {{#set: molecular-weight=636.999}} |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[ | ||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-12117
- common-name:
- demethylmenaquinol-7
- smiles:
- cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
- inchi-key:
- ufzdimbxtvrbds-ssqlmynasa-n
- molecular-weight:
- 636.999