Difference between revisions of "CPD-12117"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9521 RXN-9521] == * direction: ** left-to-right * common-name: ** trans hex-2-enoyl-[acp] reduc...")
 
(Created page with "Category:metabolite == Metabolite CPD-12117 == * common-name: ** demethylmenaquinol-7 * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=c...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9521 RXN-9521] ==
+
== Metabolite CPD-12117 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** trans hex-2-enoyl-[acp] reductase (nadph, b-specific)
+
** demethylmenaquinol-7
** fatty acid synthase
+
* smiles:
** hexanoyl-[acp] reductase
+
** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
* ec-number:
+
* inchi-key:
** [http://enzyme.expasy.org/EC/1.3.1.10 ec-1.3.1.10]
+
** ufzdimbxtvrbds-ssqlmynasa-n
** [http://enzyme.expasy.org/EC/1.3.1.39 ec-1.3.1.39]
+
* molecular-weight:
** [http://enzyme.expasy.org/EC/2.3.1.85 ec-2.3.1.85]
+
** 636.999
** [http://enzyme.expasy.org/EC/2.3.1.86 ec-2.3.1.86]
+
== Reaction(s) known to consume the compound ==
== Reaction formula ==
+
* [[RXN-9191]]
* 1 [[Hex-2-enoyl-ACPs]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[Hexanoyl-ACPs]][c] '''+''' 1 [[NADP]][c]
+
== Reaction(s) known to produce the compound ==
== Gene(s) associated with this reaction  ==
+
== Reaction(s) of unknown directionality ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
{{#set: common-name=demethylmenaquinol-7}}
* Gene: [[SJ00320]]
+
{{#set: inchi-key=inchikey=ufzdimbxtvrbds-ssqlmynasa-n}}
** Category: [[annotation]]
+
{{#set: molecular-weight=636.999}}
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
* Gene: [[SJ06944]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ03883]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
* Gene: [[SJ19629]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ04769]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ17743]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ15983]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ04443]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ06617]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ10624]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ18059]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ13014]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ00613]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ06616]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ11672]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
</div>
 
== Pathway(s) ==
 
* [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994]
 
** '''31''' reactions found over '''31''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=fatty acid synthase|hexanoyl-[acp] reductase|trans hex-2-enoyl-[acp] reductase (nadph, b-specific)}}
 
{{#set: ec-number=ec-2.3.1.86|ec-2.3.1.85|ec-1.3.1.39|ec-1.3.1.10}}
 
{{#set: nb gene associated=15}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-12117

  • common-name:
    • demethylmenaquinol-7
  • smiles:
    • cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
  • inchi-key:
    • ufzdimbxtvrbds-ssqlmynasa-n
  • molecular-weight:
    • 636.999

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality