Difference between revisions of "CPD-12117"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OCTAPRENYL-METHOXY-BENZOQUINONE == * common-name: ** 2-methoxy-6-all trans-octaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(=cccc(=cccc(=...")
(Created page with "Category:metabolite == Metabolite Guanine37-in-tRNAPhe == * common-name: ** guanine37 in trnaphe == Reaction(s) known to consume the compound == * RXN-14517 == Reactio...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OCTAPRENYL-METHOXY-BENZOQUINONE ==
+
== Metabolite Guanine37-in-tRNAPhe ==
 
* common-name:
 
* common-name:
** 2-methoxy-6-all trans-octaprenyl-1,4-benzoquinol
+
** guanine37 in trnaphe
* smiles:
 
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c)c)c
 
* inchi-key:
 
** czfrmaseeptbaq-mycgwmctsa-n
 
* molecular-weight:
 
** 685.084
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN]]
+
* [[RXN-14517]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methoxy-6-all trans-octaprenyl-1,4-benzoquinol}}
+
{{#set: common-name=guanine37 in trnaphe}}
{{#set: inchi-key=inchikey=czfrmaseeptbaq-mycgwmctsa-n}}
 
{{#set: molecular-weight=685.084}}
 

Revision as of 13:13, 14 January 2021

Metabolite Guanine37-in-tRNAPhe

  • common-name:
    • guanine37 in trnaphe

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality