Difference between revisions of "CPD-12118"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite HYPOXANTHINE == * common-name: ** hypoxanthine * smiles: ** c1(nc2(=c(n=1)n=cnc(=o)2)) * inchi-key: ** fdgqstzjbfjubt-uhfffaoysa-n * mole...") |
(Created page with "Category:metabolite == Metabolite SCOPOLIN == * common-name: ** scopolin * smiles: ** coc2(=cc1(=c(oc(c=c1)=o)c=c2oc3(c(c(c(o)c(co)o3)o)o))) * inchi-key: ** sgtcgccqzoumjj...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite SCOPOLIN == |
* common-name: | * common-name: | ||
| − | ** | + | ** scopolin |
* smiles: | * smiles: | ||
| − | ** | + | ** coc2(=cc1(=c(oc(c=c1)=o)c=c2oc3(c(c(c(o)c(co)o3)o)o))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** sgtcgccqzoumjj-ymiltqatsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 354.313 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-14179]] | |
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=scopolin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=sgtcgccqzoumjj-ymiltqatsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=354.313}} |
Revision as of 13:08, 14 January 2021
Contents
Metabolite SCOPOLIN
- common-name:
- scopolin
- smiles:
- coc2(=cc1(=c(oc(c=c1)=o)c=c2oc3(c(c(c(o)c(co)o3)o)o)))
- inchi-key:
- sgtcgccqzoumjj-ymiltqatsa-n
- molecular-weight:
- 354.313
