Difference between revisions of "CPD-12119"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NADPH-DEHYDROGENASE-RXN NADPH-DEHYDROGENASE-RXN] == * direction: ** reversible * common-name: ** na...")
(Created page with "Category:metabolite == Metabolite CPD-12122 == * common-name: ** demethylmenaquinol-13 * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=NADPH-DEHYDROGENASE-RXN NADPH-DEHYDROGENASE-RXN] ==
+
== Metabolite CPD-12122 ==
* direction:
 
** reversible
 
 
* common-name:
 
* common-name:
** nadph dehydrogenase
+
** demethylmenaquinol-13
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.6.99.1 ec-1.6.99.1]
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c)c)c
== Reaction formula ==
+
* inchi-key:
* 1 [[Acceptor]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''<=>''' 1 [[Donor-H2]][c] '''+''' 1 [[NADP]][c]
+
** hpjvtyodwhyfmv-znwikrofsa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ22257]]
+
** 1045.709
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-9366]]
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=demethylmenaquinol-13}}
== External links  ==
+
{{#set: inchi-key=inchikey=hpjvtyodwhyfmv-znwikrofsa-n}}
* RHEA:
+
{{#set: molecular-weight=1045.709}}
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13152 13152]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R00282 R00282]
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/P43084 P43084]
 
** [http://www.uniprot.org/uniprot/Q02899 Q02899]
 
** [http://www.uniprot.org/uniprot/Q03558 Q03558]
 
** [http://www.uniprot.org/uniprot/P41816 P41816]
 
** [http://www.uniprot.org/uniprot/Q42850 Q42850]
 
** [http://www.uniprot.org/uniprot/P40952 P40952]
 
{{#set: direction=reversible}}
 
{{#set: common-name=nadph dehydrogenase}}
 
{{#set: ec-number=ec-1.6.99.1}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:36, 18 December 2020

Metabolite CPD-12122

  • common-name:
    • demethylmenaquinol-13
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c)c)c
  • inchi-key:
    • hpjvtyodwhyfmv-znwikrofsa-n
  • molecular-weight:
    • 1045.709

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality