Difference between revisions of "CPD-12120"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Cerotoyl-ACPs == * common-name: ** a cerotoyl-[acp] == Reaction(s) known to consume the compound == == Reaction(s) known to produce the c...")
(Created page with "Category:metabolite == Metabolite CPD-12120 == * common-name: ** demethylmenaquinol-11 * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Cerotoyl-ACPs ==
+
== Metabolite CPD-12120 ==
 
* common-name:
 
* common-name:
** a cerotoyl-[acp]
+
** demethylmenaquinol-11
 +
* smiles:
 +
** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c
 +
* inchi-key:
 +
** wvrzwraihitkpi-sokmhqjssa-n
 +
* molecular-weight:
 +
** 909.472
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-9362]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10062]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a cerotoyl-[acp]}}
+
{{#set: common-name=demethylmenaquinol-11}}
 +
{{#set: inchi-key=inchikey=wvrzwraihitkpi-sokmhqjssa-n}}
 +
{{#set: molecular-weight=909.472}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-12120

  • common-name:
    • demethylmenaquinol-11
  • smiles:
    • cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c
  • inchi-key:
    • wvrzwraihitkpi-sokmhqjssa-n
  • molecular-weight:
    • 909.472

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality