Difference between revisions of "CPD-12120"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Cerotoyl-ACPs == * common-name: ** a cerotoyl-[acp] == Reaction(s) known to consume the compound == == Reaction(s) known to produce the c...")
(Created page with "Category:metabolite == Metabolite L-ORNITHINE == * common-name: ** l-ornithine * smiles: ** c(=o)([o-])c([n+])ccc[n+] * inchi-key: ** ahlphdhhmvztml-bypyzucnsa-o * molecul...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Cerotoyl-ACPs ==
+
== Metabolite L-ORNITHINE ==
 
* common-name:
 
* common-name:
** a cerotoyl-[acp]
+
** l-ornithine
 +
* smiles:
 +
** c(=o)([o-])c([n+])ccc[n+]
 +
* inchi-key:
 +
** ahlphdhhmvztml-bypyzucnsa-o
 +
* molecular-weight:
 +
** 133.17
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ACETYLORNDEACET-RXN]]
 +
* [[ARGINASE-RXN]]
 +
* [[ORDC]]
 +
* [[ORNCARBAMTRANSFER-RXN]]
 +
* [[ORNDECARBOX-RXN]]
 +
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 +
* [[ORNITHINE-CYCLODEAMINASE-RXN]]
 +
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 +
* [[RXN-13482]]
 +
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10062]]
+
* [[ACETYLORNDEACET-RXN]]
 +
* [[AODAA]]
 +
* [[ARGINASE-RXN]]
 +
* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
 +
* [[ORNCARBAMTRANSFER-RXN]]
 +
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 +
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 +
* [[RXN-13482]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a cerotoyl-[acp]}}
+
{{#set: common-name=l-ornithine}}
 +
{{#set: inchi-key=inchikey=ahlphdhhmvztml-bypyzucnsa-o}}
 +
{{#set: molecular-weight=133.17}}

Revision as of 13:11, 14 January 2021