Difference between revisions of "CPD-12121"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12519 RXN-12519] == * direction: ** reversible * common-name: ** peroxisomal 3,2-trans-enoyl-co...")
(Created page with "Category:metabolite == Metabolite CPD-12935 == * common-name: ** 4'-apo-β-carotenal * smiles: ** cc(c=cc=c(c)c=cc=c(c)c=o)=cc=cc=c(c)c=cc=c(c)c=cc1(c(c)(c)cccc(c)=1)...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12519 RXN-12519] ==
+
== Metabolite CPD-12935 ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** peroxisomal 3,2-trans-enoyl-coa isomerase
+
** 4'-apo-β-carotenal
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/5.3.3.8 ec-5.3.3.8]
+
** cc(c=cc=c(c)c=cc=c(c)c=o)=cc=cc=c(c)c=cc=c(c)c=cc1(c(c)(c)cccc(c)=1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[trans-2-cis-5-dienoyl-CoA]][c] '''<=>''' 1 [[trans-3-cis-5-dienoyl-CoA]][c]
+
** ftqsfezuhzhoat-brzoagjpsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ11169]]
+
** 482.748
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ07211]]
+
* [[RXN-11989]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=4'-apo-&beta;-carotenal}}
−
== Pathway(s) ==
+
{{#set: inchi-key=inchikey=ftqsfezuhzhoat-brzoagjpsa-n}}
−
* [[PWY-6837]], fatty acid beta-oxidation V (unsaturated, odd number, di-isomerase-dependent): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6837 PWY-6837]
+
{{#set: molecular-weight=482.748}}
−
** '''4''' reactions found over '''5''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=peroxisomal 3,2-trans-enoyl-coa isomerase}}
 
−
{{#set: ec-number=ec-5.3.3.8}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:36, 18 December 2020

Metabolite CPD-12935

  • common-name:
    • 4'-apo-β-carotenal
  • smiles:
    • cc(c=cc=c(c)c=cc=c(c)c=o)=cc=cc=c(c)c=cc=c(c)c=cc1(c(c)(c)cccc(c)=1)
  • inchi-key:
    • ftqsfezuhzhoat-brzoagjpsa-n
  • molecular-weight:
    • 482.748

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-12121&oldid=48003"