Difference between revisions of "CPD-12122"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite NOREPINEPHRINE == * common-name: ** (r)-noradrenaline * smiles: ** c1(c=c(o)c(=cc=1c(c[n+])o)o) * inchi-key: ** sflshlfxelfnjz-qmmmgpobsa...") |
(Created page with "Category:metabolite == Metabolite CPD-649 == * common-name: ** sphinganine 1-phosphate * smiles: ** cccccccccccccccc(c(cop([o-])(=o)[o-])[n+])o * inchi-key: ** yhedrjpuirm...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-649 == |
* common-name: | * common-name: | ||
| − | ** | + | ** sphinganine 1-phosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccccccccccccc(c(cop([o-])(=o)[o-])[n+])o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** yhedrjpuirmzmp-zwkotpchsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 380.484 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[SGPL11]] |
| + | * [[SPHINGANINE-1-PHOSPHATE-ALDOLASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[SPHINGANINE-KINASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=sphinganine 1-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yhedrjpuirmzmp-zwkotpchsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=380.484}} |
Revision as of 13:11, 14 January 2021
Contents
Metabolite CPD-649
- common-name:
- sphinganine 1-phosphate
- smiles:
- cccccccccccccccc(c(cop([o-])(=o)[o-])[n+])o
- inchi-key:
- yhedrjpuirmzmp-zwkotpchsa-m
- molecular-weight:
- 380.484
