Difference between revisions of "CPD-12124"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CA+2 == * common-name: ** ca2+ * smiles: ** [ca++] * inchi-key: ** bhpqymzqtocnfj-uhfffaoysa-n * molecular-weight: ** 40.08 == Reaction(s...")
(Created page with "Category:metabolite == Metabolite CPD-12124 == * common-name: ** menaquinol-6 * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(c=cc=cc=1c(o)=2)))c...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CA+2 ==
+
== Metabolite CPD-12124 ==
 
* common-name:
 
* common-name:
** ca2+
+
** menaquinol-6
 
* smiles:
 
* smiles:
** [ca++]
+
** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(c=cc=cc=1c(o)=2)))c
 
* inchi-key:
 
* inchi-key:
** bhpqymzqtocnfj-uhfffaoysa-n
+
** zventdgzqvbwna-rciygobdsa-n
 
* molecular-weight:
 
* molecular-weight:
** 40.08
+
** 582.908
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.6.3.8-RXN]]
 
* [[ExchangeSeed-CA+2]]
 
* [[TRANS-RXN-193]]
 
* [[TransportSeed-CA+2]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.6.3.8-RXN]]
+
* [[RXN-9220]]
* [[ExchangeSeed-CA+2]]
 
* [[TRANS-RXN-193]]
 
* [[TransportSeed-CA+2]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ca2+}}
+
{{#set: common-name=menaquinol-6}}
{{#set: inchi-key=inchikey=bhpqymzqtocnfj-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=zventdgzqvbwna-rciygobdsa-n}}
{{#set: molecular-weight=40.08}}
+
{{#set: molecular-weight=582.908}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-12124

  • common-name:
    • menaquinol-6
  • smiles:
    • cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(c=cc=cc=1c(o)=2)))c
  • inchi-key:
    • zventdgzqvbwna-rciygobdsa-n
  • molecular-weight:
    • 582.908

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality