Difference between revisions of "CPD-12124"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13996 RXN-13996] == * direction: ** reversible * ec-number: ** [http://enzyme.expasy.org/EC/3.5...") |
(Created page with "Category:metabolite == Metabolite CPD-12124 == * common-name: ** menaquinol-6 * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(c=cc=cc=1c(o)=2)))c...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-12124 == |
| − | * | + | * common-name: |
| − | ** | + | ** menaquinol-6 |
| − | * | + | * smiles: |
| − | ** | + | ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(c=cc=cc=1c(o)=2)))c |
| − | == | + | * inchi-key: |
| − | + | ** zventdgzqvbwna-rciygobdsa-n | |
| − | == | + | * molecular-weight: |
| − | * | + | ** 582.908 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-9220]] |
| − | ** | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=menaquinol-6}} | |
| − | == | + | {{#set: inchi-key=inchikey=zventdgzqvbwna-rciygobdsa-n}} |
| − | == | + | {{#set: molecular-weight=582.908}} |
| − | * | ||
| − | == | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-12124
- common-name:
- menaquinol-6
- smiles:
- cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(c=cc=cc=1c(o)=2)))c
- inchi-key:
- zventdgzqvbwna-rciygobdsa-n
- molecular-weight:
- 582.908
