Difference between revisions of "CPD-12125"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11937 == * common-name: ** 1d-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate * smiles: ** c1(op([o-])(=o)[o-])(c(op([o-])(=o)...")
(Created page with "Category:metabolite == Metabolite m7G5-pppR-mRNAs == * common-name: ** a 5'-(n7-methyl 5'-triphosphoguanosine)-(purine-ribonucleotide)-[mrna] == Reaction(s) known to consu...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11937 ==
+
== Metabolite m7G5-pppR-mRNAs ==
 
* common-name:
 
* common-name:
** 1d-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate
+
** a 5'-(n7-methyl 5'-triphosphoguanosine)-(purine-ribonucleotide)-[mrna]
* smiles:
 
** c1(op([o-])(=o)[o-])(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])op(o)(=o)[o-])c(op([o-])([o-])=o)c(op([o-])([o-])=o)1)
 
* inchi-key:
 
** uphpwxpnziozjl-ptqmnwpwsa-b
 
* molecular-weight:
 
** 727.921
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10973]]
+
* [[2.1.1.57-RXN]]
* [[RXN-10976]]
+
* [[RXN-12817]]
* [[RXN-10978]]
+
* [[RXN-12826]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10971]]
+
* [[MRNA-GUANINE-N7--METHYLTRANSFERASE-RXN]]
* [[RXN-10976]]
+
* [[RXN-12817]]
* [[RXN-10978]]
+
* [[RXN-12826]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1d-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate}}
+
{{#set: common-name=a 5'-(n7-methyl 5'-triphosphoguanosine)-(purine-ribonucleotide)-[mrna]}}
{{#set: inchi-key=inchikey=uphpwxpnziozjl-ptqmnwpwsa-b}}
 
{{#set: molecular-weight=727.921}}
 

Revision as of 18:58, 14 January 2021

Metabolite m7G5-pppR-mRNAs

  • common-name:
    • a 5'-(n7-methyl 5'-triphosphoguanosine)-(purine-ribonucleotide)-[mrna]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 5'-(n7-methyl 5'-triphosphoguanosine)-(purine-ribonucleotide)-[mrna" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.