Difference between revisions of "CPD-12125"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-113 RXN-113] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/1.14...") |
(Created page with "Category:metabolite == Metabolite CPD-12125 == * common-name: ** menaquinol-7 * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(c=cc=cc=1c(...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-12125 == |
− | * | + | * common-name: |
− | ** | + | ** menaquinol-7 |
− | * | + | * smiles: |
− | ** | + | ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(c=cc=cc=1c(o)=2)))c |
− | == | + | * inchi-key: |
− | + | ** vfgnpjrrtkmykn-ljwnyqgcsa-n | |
− | == | + | * molecular-weight: |
− | * | + | ** 651.026 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[RXN-9191]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=menaquinol-7}} | |
− | + | {{#set: inchi-key=inchikey=vfgnpjrrtkmykn-ljwnyqgcsa-n}} | |
− | + | {{#set: molecular-weight=651.026}} | |
− | |||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | == | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-12125
- common-name:
- menaquinol-7
- smiles:
- cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(c=cc=cc=1c(o)=2)))c
- inchi-key:
- vfgnpjrrtkmykn-ljwnyqgcsa-n
- molecular-weight:
- 651.026