Difference between revisions of "CPD-12125"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Beta-D-Glucans == * common-name: ** a β-d glucan == Reaction(s) known to consume the compound == == Reaction(s) known to produce the...") |
(Created page with "Category:metabolite == Metabolite CPD-12125 == * common-name: ** menaquinol-7 * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(c=cc=cc=1c(...") |
||
| (5 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-12125 == |
* common-name: | * common-name: | ||
| − | ** | + | ** menaquinol-7 |
| + | * smiles: | ||
| + | ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(c=cc=cc=1c(o)=2)))c | ||
| + | * inchi-key: | ||
| + | ** vfgnpjrrtkmykn-ljwnyqgcsa-n | ||
| + | * molecular-weight: | ||
| + | ** 651.026 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-9191]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=menaquinol-7}} |
| + | {{#set: inchi-key=inchikey=vfgnpjrrtkmykn-ljwnyqgcsa-n}} | ||
| + | {{#set: molecular-weight=651.026}} | ||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-12125
- common-name:
- menaquinol-7
- smiles:
- cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(c=cc=cc=1c(o)=2)))c
- inchi-key:
- vfgnpjrrtkmykn-ljwnyqgcsa-n
- molecular-weight:
- 651.026
