Difference between revisions of "CPD-12125"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MANNOSE-6P == * common-name: ** α-d-mannopyranose 6-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1) * inchi-key: *...") |
(Created page with "Category:metabolite == Metabolite Beta-D-Glucans == * common-name: ** a β-d glucan == Reaction(s) known to consume the compound == == Reaction(s) known to produce the...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Beta-D-Glucans == |
* common-name: | * common-name: | ||
| − | ** & | + | ** a β-d glucan |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3.2.1.6-RXN]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=& | + | {{#set: common-name=a β-d glucan}} |
| − | |||
| − | |||
Revision as of 14:59, 5 January 2021
Contents
Metabolite Beta-D-Glucans
- common-name:
- a β-d glucan
