Difference between revisions of "CPD-12125"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Beta-D-Glucans == * common-name: ** a β-d glucan == Reaction(s) known to consume the compound == == Reaction(s) known to produce the...") |
(Created page with "Category:metabolite == Metabolite INDOLE-3-GLYCOL == * common-name: ** indole-3-glycol * smiles: ** c2(=c(c1(c=cc=cc=1n2))c(o)co) * inchi-key: ** xnjdzrgywqbbmz-uhfffaoysa...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite INDOLE-3-GLYCOL == |
* common-name: | * common-name: | ||
− | ** | + | ** indole-3-glycol |
+ | * smiles: | ||
+ | ** c2(=c(c1(c=cc=cc=1n2))c(o)co) | ||
+ | * inchi-key: | ||
+ | ** xnjdzrgywqbbmz-uhfffaoysa-n | ||
+ | * molecular-weight: | ||
+ | ** 177.202 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-5424]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=indole-3-glycol}} |
+ | {{#set: inchi-key=inchikey=xnjdzrgywqbbmz-uhfffaoysa-n}} | ||
+ | {{#set: molecular-weight=177.202}} |
Revision as of 15:29, 5 January 2021
Contents
Metabolite INDOLE-3-GLYCOL
- common-name:
- indole-3-glycol
- smiles:
- c2(=c(c1(c=cc=cc=1n2))c(o)co)
- inchi-key:
- xnjdzrgywqbbmz-uhfffaoysa-n
- molecular-weight:
- 177.202