Difference between revisions of "CPD-12125"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite INDOLE-3-GLYCOL == * common-name: ** indole-3-glycol * smiles: ** c2(=c(c1(c=cc=cc=1n2))c(o)co) * inchi-key: ** xnjdzrgywqbbmz-uhfffaoysa...")
(Created page with "Category:metabolite == Metabolite CPD-11937 == * common-name: ** 1d-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate * smiles: ** c1(op([o-])(=o)[o-])(c(op([o-])(=o)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite INDOLE-3-GLYCOL ==
+
== Metabolite CPD-11937 ==
 
* common-name:
 
* common-name:
** indole-3-glycol
+
** 1d-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate
 
* smiles:
 
* smiles:
** c2(=c(c1(c=cc=cc=1n2))c(o)co)
+
** c1(op([o-])(=o)[o-])(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])op(o)(=o)[o-])c(op([o-])([o-])=o)c(op([o-])([o-])=o)1)
 
* inchi-key:
 
* inchi-key:
** xnjdzrgywqbbmz-uhfffaoysa-n
+
** uphpwxpnziozjl-ptqmnwpwsa-b
 
* molecular-weight:
 
* molecular-weight:
** 177.202
+
** 727.921
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-10973]]
 +
* [[RXN-10976]]
 +
* [[RXN-10978]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-5424]]
+
* [[RXN-10971]]
 +
* [[RXN-10976]]
 +
* [[RXN-10978]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=indole-3-glycol}}
+
{{#set: common-name=1d-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate}}
{{#set: inchi-key=inchikey=xnjdzrgywqbbmz-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=uphpwxpnziozjl-ptqmnwpwsa-b}}
{{#set: molecular-weight=177.202}}
+
{{#set: molecular-weight=727.921}}

Revision as of 13:12, 14 January 2021

Metabolite CPD-11937

  • common-name:
    • 1d-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate
  • smiles:
    • c1(op([o-])(=o)[o-])(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])op(o)(=o)[o-])c(op([o-])([o-])=o)c(op([o-])([o-])=o)1)
  • inchi-key:
    • uphpwxpnziozjl-ptqmnwpwsa-b
  • molecular-weight:
    • 727.921

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality