Difference between revisions of "CPD-12127"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-696 == * common-name: ** 24-methylenecycloartanol * smiles: ** cc(c)c(=c)ccc(c)[ch]3(ccc4(c)([ch]1(cc[ch]5(c(c)(c)c(o)ccc2(cc12ccc(c)...")
(Created page with "Category:metabolite == Metabolite CPD-12127 == * common-name: ** menaquinol-10 * smiles: ** cc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-696 ==
+
== Metabolite CPD-12127 ==
 
* common-name:
 
* common-name:
** 24-methylenecycloartanol
+
** menaquinol-10
 
* smiles:
 
* smiles:
** cc(c)c(=c)ccc(c)[ch]3(ccc4(c)([ch]1(cc[ch]5(c(c)(c)c(o)ccc2(cc12ccc(c)34)5))))
+
** cc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c
 
* inchi-key:
 
* inchi-key:
** bdhqmrxfdyjgii-xpnryqhysa-n
+
** wlkiromwgyxjma-uqunhumxsa-n
 
* molecular-weight:
 
* molecular-weight:
** 440.751
+
** 855.381
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-4021]]
+
* [[RXN-9361]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=24-methylenecycloartanol}}
+
{{#set: common-name=menaquinol-10}}
{{#set: inchi-key=inchikey=bdhqmrxfdyjgii-xpnryqhysa-n}}
+
{{#set: inchi-key=inchikey=wlkiromwgyxjma-uqunhumxsa-n}}
{{#set: molecular-weight=440.751}}
+
{{#set: molecular-weight=855.381}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-12127

  • common-name:
    • menaquinol-10
  • smiles:
    • cc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c
  • inchi-key:
    • wlkiromwgyxjma-uqunhumxsa-n
  • molecular-weight:
    • 855.381

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality