Difference between revisions of "CPD-12128"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Deamido-bleomycins == * common-name: ** a deamido-bleomycin == Reaction(s) known to consume the compound == == Reaction(s) known to produ...") |
(Created page with "Category:metabolite == Metabolite CPD-12128 == * common-name: ** menaquinol-11 * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)...") |
||
| (5 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-12128 == |
* common-name: | * common-name: | ||
| − | ** | + | ** menaquinol-11 |
| + | * smiles: | ||
| + | ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c | ||
| + | * inchi-key: | ||
| + | ** zxhqkrgmwkzwgn-ryzszpjesa-n | ||
| + | * molecular-weight: | ||
| + | ** 923.499 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-9362]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=menaquinol-11}} |
| + | {{#set: inchi-key=inchikey=zxhqkrgmwkzwgn-ryzszpjesa-n}} | ||
| + | {{#set: molecular-weight=923.499}} | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-12128
- common-name:
- menaquinol-11
- smiles:
- cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c
- inchi-key:
- zxhqkrgmwkzwgn-ryzszpjesa-n
- molecular-weight:
- 923.499
