Difference between revisions of "CPD-12129"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15370 == * common-name: ** trans-lesqueroloyl-coa * smiles: ** ccccccc(o)cc=ccccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...")
(Created page with "Category:metabolite == Metabolite CPD-12129 == * common-name: ** menaquinol-12 * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=c...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15370 ==
+
== Metabolite CPD-12129 ==
 
* common-name:
 
* common-name:
** trans-lesqueroloyl-coa
+
** menaquinol-12
 
* smiles:
 
* smiles:
** ccccccc(o)cc=ccccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** cc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c)c
 
* inchi-key:
 
* inchi-key:
** fgrjeqcmqcquqf-fscwmumrsa-j
+
** fwfjgqgpmzxtlm-wppieqshsa-n
 
* molecular-weight:
 
* molecular-weight:
** 1069.99
+
** 991.617
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14494]]
+
* [[RXN-9363]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=trans-lesqueroloyl-coa}}
+
{{#set: common-name=menaquinol-12}}
{{#set: inchi-key=inchikey=fgrjeqcmqcquqf-fscwmumrsa-j}}
+
{{#set: inchi-key=inchikey=fwfjgqgpmzxtlm-wppieqshsa-n}}
{{#set: molecular-weight=1069.99}}
+
{{#set: molecular-weight=991.617}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-12129

  • common-name:
    • menaquinol-12
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c)c
  • inchi-key:
    • fwfjgqgpmzxtlm-wppieqshsa-n
  • molecular-weight:
    • 991.617

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality