Difference between revisions of "CPD-12129"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite METHYLARSONITE == * common-name: ** methylarsonite * smiles: ** c[as](o)o * inchi-key: ** oxbirpqqkcqwgv-uhfffaoysa-n * molecular-weight:...") |
(Created page with "Category:metabolite == Metabolite CPD-12129 == * common-name: ** menaquinol-12 * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=c...") |
||
| (3 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-12129 == |
* common-name: | * common-name: | ||
| − | ** | + | ** menaquinol-12 |
* smiles: | * smiles: | ||
| − | ** c | + | ** cc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fwfjgqgpmzxtlm-wppieqshsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 991.617 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-9363]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=menaquinol-12}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fwfjgqgpmzxtlm-wppieqshsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=991.617}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-12129
- common-name:
- menaquinol-12
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c)c
- inchi-key:
- fwfjgqgpmzxtlm-wppieqshsa-n
- molecular-weight:
- 991.617
