Difference between revisions of "CPD-12130"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite XANTHOSINE == * common-name: ** xanthosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23))) * inchi-key: ** ubortcndukbeop-u...") |
(Created page with "Category:metabolite == Metabolite CPD-12130 == * common-name: ** menaquinol-13 * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc...") |
||
| (4 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-12130 == |
* common-name: | * common-name: | ||
| − | ** | + | ** menaquinol-13 |
* smiles: | * smiles: | ||
| − | ** c( | + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zlhyydgaqjjtjl-hwrcdasfsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 1059.735 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-9366]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=menaquinol-13}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zlhyydgaqjjtjl-hwrcdasfsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=1059.735}} |
Latest revision as of 11:10, 18 March 2021
Contents
Metabolite CPD-12130
- common-name:
- menaquinol-13
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c)c)c
- inchi-key:
- zlhyydgaqjjtjl-hwrcdasfsa-n
- molecular-weight:
- 1059.735
