Difference between revisions of "CPD-12130"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ04983 == * transcription-direction: ** negative * right-end-position: ** 646936 * left-end-position: ** 626201 * centisome-position: ** 64.848694...") |
(Created page with "Category:metabolite == Metabolite CPD-12130 == * common-name: ** menaquinol-13 * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-12130 == |
| − | * | + | * common-name: |
| − | ** | + | ** menaquinol-13 |
| − | * | + | * smiles: |
| − | ** | + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c)c)c |
| − | * | + | * inchi-key: |
| − | ** | + | ** zlhyydgaqjjtjl-hwrcdasfsa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 1059.735 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | * [[RXN-9366]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=menaquinol-13}} | |
| − | + | {{#set: inchi-key=inchikey=zlhyydgaqjjtjl-hwrcdasfsa-n}} | |
| − | * [[RXN- | + | {{#set: molecular-weight=1059.735}} |
| − | |||
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:10, 18 March 2021
Contents
Metabolite CPD-12130
- common-name:
- menaquinol-13
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c)c)c
- inchi-key:
- zlhyydgaqjjtjl-hwrcdasfsa-n
- molecular-weight:
- 1059.735
