Difference between revisions of "CPD-12130"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UDP-GLUCURONATE == * common-name: ** udp-α-d-glucuronate * smiles: ** c(c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))op(=o)([o-])op(=o)([o-...")
(Created page with "Category:gene == Gene SJ04983 == * transcription-direction: ** negative * right-end-position: ** 646936 * left-end-position: ** 626201 * centisome-position: ** 64.848694...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite UDP-GLUCURONATE ==
+
== Gene SJ04983 ==
* common-name:
+
* transcription-direction:
** udp-α-d-glucuronate
+
** negative
* smiles:
+
* right-end-position:
** c(c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))op(=o)([o-])op(=o)([o-])oc3(oc(c([o-])=o)c(o)c(o)c(o)3)
+
** 646936
* inchi-key:
+
* left-end-position:
** hdyanyhvcapmjv-lxqifkjmsa-k
+
** 626201
* molecular-weight:
+
* centisome-position:
** 577.265
+
** 64.848694   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[S.japonica_carotenoid_curated]]
* [[2.4.1.212-RXN]]
+
== Reaction(s) associated ==
* [[2.4.1.225-RXN]]
+
* [[PROTEIN-KINASE-RXN]]
* [[2.7.7.44-RXN]]
+
** Category: [[annotation]]
* [[RXN-10606]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-10607]]
+
* [[RXN-8443]]
* [[RXN-10608]]
+
** Category: [[orthology]]
* [[RXN-10609]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* [[RXN-10616]]
+
== Pathway(s) associated ==
* [[RXN-10617]]
+
* [[PWY-5381]]
* [[RXN-10618]]
+
** '''6''' reactions found over '''11''' reactions in the full pathway
* [[RXN-10619]]
+
{{#set: transcription-direction=negative}}
* [[RXN-10784]]
+
{{#set: right-end-position=646936}}
* [[RXN-11060]]
+
{{#set: left-end-position=626201}}
* [[RXN-13607]]
+
{{#set: centisome-position=64.848694    }}
* [[RXN-13608]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
* [[RXN-14361]]
+
{{#set: nb reaction associated=2}}
* [[RXN-9000]]
+
{{#set: nb pathway associated=1}}
* [[RXN66-162]]
 
* [[RXN66-168]]
 
* [[RXN66-83]]
 
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
 
* [[UDP-GLUCURONATE-DECARBOXYLASE-RXN]]
 
* [[UDP-GLUCURONOSYLTRANSFERASE-RXN]]
 
* [[UGDC]]
 
</div>
 
== Reaction(s) known to produce the compound ==
 
* [[2.7.7.44-RXN]]
 
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
 
* [[UGD-RXN]]
 
* [[UGDH]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=udp-&alpha;-d-glucuronate}}
 
{{#set: inchi-key=inchikey=hdyanyhvcapmjv-lxqifkjmsa-k}}
 
{{#set: molecular-weight=577.265}}
 

Revision as of 18:52, 14 January 2021

Gene SJ04983

  • transcription-direction:
    • negative
  • right-end-position:
    • 646936
  • left-end-position:
    • 626201
  • centisome-position:
    • 64.848694

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-5381
    • 6 reactions found over 11 reactions in the full pathway