Difference between revisions of "CPD-12173"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17388 == * common-name: ** 3-oxo-(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)cc(sccnc...") |
(Created page with "Category:metabolite == Metabolite CPD-8678 == * common-name: ** 9(s)-hpote * smiles: ** ccc=ccc=cc=cc(cccccccc([o-])=o)oo * inchi-key: ** rwkjtihnysiihw-mebvtjqtsa-m * mol...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-8678 == |
* common-name: | * common-name: | ||
− | ** | + | ** 9(s)-hpote |
* smiles: | * smiles: | ||
− | ** ccc=ccc= | + | ** ccc=ccc=cc=cc(cccccccc([o-])=o)oo |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** rwkjtihnysiihw-mebvtjqtsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 309.425 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-8497]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=9(s)-hpote}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rwkjtihnysiihw-mebvtjqtsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=309.425}} |
Revision as of 13:08, 14 January 2021
Contents
Metabolite CPD-8678
- common-name:
- 9(s)-hpote
- smiles:
- ccc=ccc=cc=cc(cccccccc([o-])=o)oo
- inchi-key:
- rwkjtihnysiihw-mebvtjqtsa-m
- molecular-weight:
- 309.425