Difference between revisions of "CPD-12175"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3481 == * common-name: ** bupropion * smiles: ** cc([n+]c(c)(c)c)c(=o)c1(c=cc=c(cl)c=1) * inchi-key: ** snppwiuozrmyny-uhfffaoysa-o *...") |
(Created page with "Category:metabolite == Metabolite CPD-12175 == * common-name: ** (s)-3-hydroxy-isobutanoate * smiles: ** cc(c([o-])=o)co * inchi-key: ** dbxbtmszeoqqdu-vkhmyheasa-m * mole...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-12175 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (s)-3-hydroxy-isobutanoate |
* smiles: | * smiles: | ||
| − | ** cc([ | + | ** cc(c([o-])=o)co |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** dbxbtmszeoqqdu-vkhmyheasa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 103.097 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[3-HYDROXYISOBUTYRATE-DEHYDROGENASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[3-HYDROXYISOBUTYRYL-COA-HYDROLASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(s)-3-hydroxy-isobutanoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=dbxbtmszeoqqdu-vkhmyheasa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=103.097}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-12175
- common-name:
- (s)-3-hydroxy-isobutanoate
- smiles:
- cc(c([o-])=o)co
- inchi-key:
- dbxbtmszeoqqdu-vkhmyheasa-m
- molecular-weight:
- 103.097
